CAS 2651-55-0 appears in our catalog under these names: 3-Ethoxy-4-methoxybenzoic acid, 98%, 3-Ethoxy-4-methoxybenzoic acid, 98% , 3-Ethoxy-4-methoxybenzoic acid, 3-Ethoxy-4-methoxybenzoic acid, 98%(GC-MS),RG, 3-Ethoxy-4-methoxybenzoic acid, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Fluorochem, Ambeed. Available pack sizes: 25g, 1g, 5g, 250mg.
3-ethoxy-4-methoxybenzoic acid (CAS 2651-55-0) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 3-ethoxy-4-methoxybenzoic acid. InChIKey: DMSAIFTWQMXOBE-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3-ethoxy-4-methoxybenzoic acid |
| InChIKey | DMSAIFTWQMXOBE-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)O)OC |
Computed by PubChem (NCBI)