CAS 2150-41-6 appears in our catalog under these names: Methyl 2,4-dimethoxybenzoate, 98%, Methyl 2,4–Dimethoxybenzoate, Methyl 2,4-Dimethoxybenzoate, >98.0%(GC), Methyl 2,4-dimethoxybenzoate, 97%, 97%, Methyl 2,4-dimethoxybenzoate, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 10g, 1g.
Methyl 2,4-dimethoxybenzoate (CAS 2150-41-6) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2,4-dimethoxybenzoate. InChIKey: IHIJFZWLGPEYPJ-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2,4-dimethoxybenzoate |
| InChIKey | IHIJFZWLGPEYPJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)OC)OC |
Computed by PubChem (NCBI)