cas: 171364-84-4 — see every product listed under this CAS number, including other names
2,4,6-Trimethylbenzeneboronic acid pinacol ester, 95% (CAS 171364-84-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513592-1G |
| cas | 171364-84-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 10g | 450.90 Pln | |
| Fluorochem | 25g | 971.55 Pln | |
| Fluorochem | 100g | 3059.36 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4,4,5,5-tetramethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborolane (CAS 171364-84-4) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborolane. InChIKey: MUSASZSRBLWJQA-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,4,6-trimethylphenyl)-1,3,2-dioxaborolane |
| InChIKey | MUSASZSRBLWJQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)