2,4,6-Triphenylpyrylium tetrafluoroborate, 95%
cas: 448-61-3 — see every product listed under this CAS number, including other names
2,4,6-Triphenylpyrylium tetrafluoroborate, 95% (CAS 448-61-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F239833-1G |
| cas | 448-61-3 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 180.16 Pln | |
| Fluorochem | 10g | 211.40 Pln | |
| Fluorochem | 25g | 424.87 Pln | |
| Fluorochem | 100g | 1513.03 Pln | |
| Fluorochem | 500g | 5287.74 Pln | |
| Fluorochem | 1kg | 8770.89 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 236.88 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1527.38 Pln | |
| Ambeed | 500g | 5671.44 Pln | |
| Ambeed | 1kg | 9598.56 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2,4,6-triphenylpyrylium tetrafluoroborate (CAS 448-61-3) is a chemical compound with the molecular formula C23H17BF4O and a molecular weight of 396.2 g/mol. IUPAC name: 2,4,6-triphenylpyrylium tetrafluoroborate. InChIKey: VQYPWMWEJGDSTF-UHFFFAOYSA-N.
| Molecular formula | C23H17BF4O |
|---|---|
| Molecular weight | 396.2 g/mol |
| IUPAC name | 2,4,6-triphenylpyrylium tetrafluoroborate |
| InChIKey | VQYPWMWEJGDSTF-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)C2=CC(=[O+]C(=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-Triphenylpyrylium tetrafluoroborate, Pyrylium, 2,4,6-triphenyl-, tetrafluoroborate(1-), 2,4,6-Triphenylpyrylium fluoroborate, 2,4,6-triphenylpyryliumtetrafluoroborate, 2,4,6-triphenylpyrylium;tetrafluoroborate, 2,4,6-Triphenylpyrylium tetrafluoroborat, 2,4,6-triphenyl-1lambda4-pyran-1-ylium; tetrafluoroboranuide, 2,4,6-triphenyl-pyrylium tetrafluoroborate, 2,4,6-Triphenylpyrylium tetrafluoroborate, 98%, 2,4,6-Triphenylpyran-1-ium tetrafluoridoborate(1-)