CAS 448-61-3 appears in our catalog under these names: 2,4,6–Triphenylpyrylium tetrafluoroborate, 2,4,6-Triphenylpyrylium tetrafluoroborate, 97% , 2,4,6-Triphenylpyrylium Tetrafluoroborate, >95.0%(T), 2,4,6-TRIPHENYLPYRYLIUM TETRAFLUOROBORAT, 2,4,6-Triphenylpyrylium fluoroborate, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 100g, 25g, 1g, 10g, 500g, 1kg, 5kg.
2,4,6-triphenylpyrylium tetrafluoroborate (CAS 448-61-3) is a chemical compound with the molecular formula C23H17BF4O and a molecular weight of 396.2 g/mol. IUPAC name: 2,4,6-triphenylpyrylium tetrafluoroborate. InChIKey: VQYPWMWEJGDSTF-UHFFFAOYSA-N.
| Molecular formula | C23H17BF4O |
|---|---|
| Molecular weight | 396.2 g/mol |
| IUPAC name | 2,4,6-triphenylpyrylium tetrafluoroborate |
| InChIKey | VQYPWMWEJGDSTF-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)C2=CC(=[O+]C(=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)