CAS 174566-16-6 is the registry number for 2,4,7-Trichloro-6-fluoroquinazoline, 98%. Offered by: Ambeed. Available pack sizes: 50mg, 250mg, 1g, 5g, 25mg.
2,4,7-trichloro-6-fluoroquinazoline (CAS 174566-16-6) is a chemical compound with the molecular formula C8H2Cl3FN2 and a molecular weight of 251.5 g/mol. IUPAC name: 2,4,7-trichloro-6-fluoroquinazoline. InChIKey: WSNAPGCKSBRSKD-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl3FN2 |
|---|---|
| Molecular weight | 251.5 g/mol |
| IUPAC name | 2,4,7-trichloro-6-fluoroquinazoline |
| InChIKey | WSNAPGCKSBRSKD-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Cl)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)