CAS 2892635-63-9 appears in our catalog under these names: 2,4,7-Trichloro-8-fluoro-1,6-naphthyridine, 98%, 1,6-Naphthyridine, 2,4,7-trichloro-8-fluoro-, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
2,4,7-trichloro-8-fluoro-1,6-naphthyridine (CAS 2892635-63-9) is a chemical compound with the molecular formula C8H2Cl3FN2 and a molecular weight of 251.5 g/mol. IUPAC name: 2,4,7-trichloro-8-fluoro-1,6-naphthyridine. InChIKey: JKMVDTJJVIMOIH-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl3FN2 |
|---|---|
| Molecular weight | 251.5 g/mol |
| IUPAC name | 2,4,7-trichloro-8-fluoro-1,6-naphthyridine |
| InChIKey | JKMVDTJJVIMOIH-UHFFFAOYSA-N |
| SMILES | C1=C(C2=CN=C(C(=C2N=C1Cl)F)Cl)Cl |
Computed by PubChem (NCBI)