CAS 2384821-13-8 is the registry number for 2,4,7-Trichloro-5-fluoroquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,7-trichloro-5-fluoroquinazoline (CAS 2384821-13-8) is a chemical compound with the molecular formula C8H2Cl3FN2 and a molecular weight of 251.5 g/mol. IUPAC name: 2,4,7-trichloro-5-fluoroquinazoline. InChIKey: BXFHKAOYUCSCET-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl3FN2 |
|---|---|
| Molecular weight | 251.5 g/mol |
| IUPAC name | 2,4,7-trichloro-5-fluoroquinazoline |
| InChIKey | BXFHKAOYUCSCET-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(N=C2Cl)Cl)F)Cl |
Computed by PubChem (NCBI)