cas: 376637-88-6 — see every product listed under this CAS number, including other names
2,4-Bis(trifluoromethyl)benzene-1-sulfonyl chloride, 97% (CAS 376637-88-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1219276-1g |
| cas | 376637-88-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 13441.54 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-bis(trifluoromethyl)benzenesulfonyl chloride (CAS 376637-88-6) is a chemical compound with the molecular formula C8H3ClF6O2S and a molecular weight of 312.62 g/mol. IUPAC name: 2,4-bis(trifluoromethyl)benzenesulfonyl chloride. InChIKey: KSOZFWPHXQNOEB-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF6O2S |
|---|---|
| Molecular weight | 312.62 g/mol |
| IUPAC name | 2,4-bis(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | KSOZFWPHXQNOEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)