CAS 39234-86-1 appears in our catalog under these names: 3,5–Bis(trifluoromethyl)benzenesulfonyl chloride, 3,5-Bis(trifluoromethyl)benzenesulfonyl chloride, 97% , 3,5-Bis(trifluoromethyl)benzenesulfonyl Chloride, >98.0%(GC)(T), 3,5-Bis(trifluoromethyl)benzene-1-sulfonyl chloride 98%, 3,5-Bis(trifluoromethyl)benzene-1-sulfonyl chloride, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 5g, 500g, 10g.
3,5-bis(trifluoromethyl)benzenesulfonyl chloride (CAS 39234-86-1) is a chemical compound with the molecular formula C8H3ClF6O2S and a molecular weight of 312.62 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)benzenesulfonyl chloride. InChIKey: BTRCVKADYDVSLI-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF6O2S |
|---|---|
| Molecular weight | 312.62 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | BTRCVKADYDVSLI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)