Products 376637-88-6

CAS 376637-88-6 appears in our catalog under these names: 2,4-Bis(trifluoromethyl)benzenesulfonyl chloride, 95%, 2,4-Bis(trifluoromethyl)benzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2,4-bis(trifluoromethyl)benzenesulfonyl chloride (CAS 376637-88-6) is a chemical compound with the molecular formula C8H3ClF6O2S and a molecular weight of 312.62 g/mol. IUPAC name: 2,4-bis(trifluoromethyl)benzenesulfonyl chloride. InChIKey: KSOZFWPHXQNOEB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3ClF6O2S
Molecular weight312.62 g/mol
IUPAC name2,4-bis(trifluoromethyl)benzenesulfonyl chloride
InChIKeyKSOZFWPHXQNOEB-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)