2,4-Bis(trifluoromethyl)phenylboronic acid, 98%
cas: 153254-09-2 — see every product listed under this CAS number, including other names
2,4-Bis(trifluoromethyl)phenylboronic acid, 98% (CAS 153254-09-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F049833-1G |
| cas | 153254-09-2 |
| size | 1g |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 117.68 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 216.61 Pln | |
| Fluorochem | 100g | 695.61 Pln | |
| Fluorochem | 500g | 2897.96 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 676.31 Pln | |
| Ambeed | 500g | 3096.00 Pln | |
| Ambeed | 1kg | 4914.94 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
[2,4-bis(trifluoromethyl)phenyl]boronic acid (CAS 153254-09-2) is a chemical compound with the molecular formula C8H5BF6O2 and a molecular weight of 257.93 g/mol. IUPAC name: [2,4-bis(trifluoromethyl)phenyl]boronic acid. InChIKey: WLYPBMBWKYALCG-UHFFFAOYSA-N.
| Molecular formula | C8H5BF6O2 |
|---|---|
| Molecular weight | 257.93 g/mol |
| IUPAC name | [2,4-bis(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WLYPBMBWKYALCG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Bis(trifluoromethyl)phenylboronic acid, [2,4-bis(trifluoromethyl)phenyl]boronic Acid, (2,4-bis(trifluoromethyl)phenyl)boronic acid, 2,4-Bis(trifluoromethyl)benzeneboronic Acid, 2,4-bis(trifluoromethyl) phenylboronic acid, 2,4-di-(trifluoromethyl)phenyl boronic acid, 2,4-Bis(trifluoromethyl)phenylboronicacid, 2,4-Bis(Trifluoromethyl)Phenyl, 2,4-bistrifluoromethylbenzeneboronic acid, 2,4-bistrifluoromethyl-phenylboronic acid