Products 1204745-88-9

CAS 1204745-88-9 appears in our catalog under these names: 3,4-Bis(trifluoromethyl) phenylboronic acid, 96%, 3,4-Bis(trifluoromethyl)phenylboronic acid, 98%, (3,4-Bis(trifluoromethyl)phenyl)boronic acid, 3,4-Bis(trifluoromethyl)phenylboronic acid 96%, 3,4-Bis(trifluoromethyl)phenylboronic acid, 96%, 96%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 0,5g, 2g, 100mg.

Structural formula: {0} (CAS {1})

[3,4-bis(trifluoromethyl)phenyl]boronic acid (CAS 1204745-88-9) is a chemical compound with the molecular formula C8H5BF6O2 and a molecular weight of 257.93 g/mol. IUPAC name: [3,4-bis(trifluoromethyl)phenyl]boronic acid. InChIKey: GIZQTQOXIWPFOA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BF6O2
Molecular weight257.93 g/mol
IUPAC name[3,4-bis(trifluoromethyl)phenyl]boronic acid
InChIKeyGIZQTQOXIWPFOA-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)C(F)(F)F)C(F)(F)F)(O)O

Computed by PubChem (NCBI)