CAS 927673-87-8 is the registry number for (2,3-Bis(trifluoromethyl)phenyl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2,3-bis(trifluoromethyl)phenyl]boronic acid (CAS 927673-87-8) is a chemical compound with the molecular formula C8H5BF6O2 and a molecular weight of 257.93 g/mol. IUPAC name: [2,3-bis(trifluoromethyl)phenyl]boronic acid. InChIKey: AHWZCYVXODSVGD-UHFFFAOYSA-N.
| Molecular formula | C8H5BF6O2 |
|---|---|
| Molecular weight | 257.93 g/mol |
| IUPAC name | [2,3-bis(trifluoromethyl)phenyl]boronic acid |
| InChIKey | AHWZCYVXODSVGD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(F)(F)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)