CAS 2163-12-4 appears in our catalog under these names: 1,1'–(2,4–Dihydroxy–1,3–phenylene)bis(ethan–1–one), 1,1'-(2,4-Dihydroxy-1,3-phenylene)bis(ethan-1-one) 97%, 1,1'-(2,4-Dihydroxy-1,3-Phenylene)Bis(Ethan-1-One), 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-acetyl-2,4-dihydroxyphenyl)ethanone (CAS 2163-12-4) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 1-(3-acetyl-2,4-dihydroxyphenyl)ethanone. InChIKey: AONRSNZGOMBWPX-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 1-(3-acetyl-2,4-dihydroxyphenyl)ethanone |
| InChIKey | AONRSNZGOMBWPX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)O)C(=O)C)O |
Computed by PubChem (NCBI)