cas: 2121511-89-3 — see every product listed under this CAS number, including other names
2,4-Dibromo-5-fluorophenylboronic acid (CAS 2121511-89-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627604-1G |
| cas | 2121511-89-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5719.88 Pln |
| delivery time | 3-4 weeks |
|---|
(2,4-dibromo-5-fluorophenyl)boronic acid (CAS 2121511-89-3) is a chemical compound with the molecular formula C6H4BBr2FO2 and a molecular weight of 297.71 g/mol. IUPAC name: (2,4-dibromo-5-fluorophenyl)boronic acid. InChIKey: ODEDYKQPEFYELP-UHFFFAOYSA-N.
| Molecular formula | C6H4BBr2FO2 |
|---|---|
| Molecular weight | 297.71 g/mol |
| IUPAC name | (2,4-dibromo-5-fluorophenyl)boronic acid |
| InChIKey | ODEDYKQPEFYELP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Br)Br)F)(O)O |
Computed by PubChem (NCBI)