cas: 4487-57-4 — see every product listed under this CAS number, including other names
2,4-Dibromo-5-nitropyridine 98% (CAS 4487-57-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A434999-250mg |
| cas | 4487-57-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 420.44 Pln | |
| Ambeed | 10g | 642.94 Pln | |
| Ambeed | 25g | 1494.00 Pln | |
| Ambeed | 100g | 5243.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A434999 |
2,4-dibromo-5-nitropyridine (CAS 4487-57-4) is a chemical compound with the molecular formula C5H2Br2N2O2 and a molecular weight of 281.89 g/mol. IUPAC name: 2,4-dibromo-5-nitropyridine. InChIKey: RZZGFCFQBVRQSX-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N2O2 |
|---|---|
| Molecular weight | 281.89 g/mol |
| IUPAC name | 2,4-dibromo-5-nitropyridine |
| InChIKey | RZZGFCFQBVRQSX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)