2,4-Dibromo-5-nitropyridine, 99.42%
cas: 4487-57-4 — see every product listed under this CAS number, including other names
2,4-Dibromo-5-nitropyridine, 99.42% (CAS 4487-57-4) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 5 g, 10 g, 100 g, 500 mg, 50 g, 1 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-100062-25 g |
| cas | 4487-57-4 |
| size | 25 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 2590.61 Pln | |
| MedChemExpress | 5 g | 909.48 Pln | |
| MedChemExpress | 10 g | 1369.24 Pln | |
| MedChemExpress | 100 g | 6380.11 Pln | |
| MedChemExpress | 500 mg | 333.62 Pln | |
| MedChemExpress | 50 g | 4053.47 Pln | |
| MedChemExpress | 1 g | 454.37 Pln | |
| MedChemExpress | 250 mg | 263.96 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.42% |
2,4-dibromo-5-nitropyridine (CAS 4487-57-4) is a chemical compound with the molecular formula C5H2Br2N2O2 and a molecular weight of 281.89 g/mol. IUPAC name: 2,4-dibromo-5-nitropyridine. InChIKey: RZZGFCFQBVRQSX-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N2O2 |
|---|---|
| Molecular weight | 281.89 g/mol |
| IUPAC name | 2,4-dibromo-5-nitropyridine |
| InChIKey | RZZGFCFQBVRQSX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)