cas: 94115-05-6 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-(1,1-dimethylethyl)benzenamine, 97%, 97% (CAS 94115-05-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHXX-250mg |
| cas | 94115-05-6 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1101.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dibromo-6-tert-butylaniline (CAS 94115-05-6) is a chemical compound with the molecular formula C10H13Br2N and a molecular weight of 307.02 g/mol. IUPAC name: 2,4-dibromo-6-tert-butylaniline. InChIKey: RZSNBOTYWWDTTP-UHFFFAOYSA-N.
| Molecular formula | C10H13Br2N |
|---|---|
| Molecular weight | 307.02 g/mol |
| IUPAC name | 2,4-dibromo-6-tert-butylaniline |
| InChIKey | RZSNBOTYWWDTTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)