CAS 1951439-61-4 is the registry number for 1-(4-Bromophenyl)cyclobutan-1-amine hydrobromide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(4-bromophenyl)cyclobutan-1-amine;hydrobromide (CAS 1951439-61-4) is a chemical compound with the molecular formula C10H13Br2N and a molecular weight of 307.02 g/mol. IUPAC name: 1-(4-bromophenyl)cyclobutan-1-amine;hydrobromide. InChIKey: KZZIUGIGVQDGJM-UHFFFAOYSA-N.
| Molecular formula | C10H13Br2N |
|---|---|
| Molecular weight | 307.02 g/mol |
| IUPAC name | 1-(4-bromophenyl)cyclobutan-1-amine;hydrobromide |
| InChIKey | KZZIUGIGVQDGJM-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=C(C=C2)Br)N.Br |
Computed by PubChem (NCBI)