CAS 1427380-43-5 appears in our catalog under these names: 7-Bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline hydrobromide, 95%, 7-Bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline hydrobromide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 2,5g.
7-bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline;hydrobromide (CAS 1427380-43-5) is a chemical compound with the molecular formula C10H13Br2N and a molecular weight of 307.02 g/mol. IUPAC name: 7-bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline;hydrobromide. InChIKey: NCDNVPCBBKOBOH-UHFFFAOYSA-N.
| Molecular formula | C10H13Br2N |
|---|---|
| Molecular weight | 307.02 g/mol |
| IUPAC name | 7-bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline;hydrobromide |
| InChIKey | NCDNVPCBBKOBOH-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(CN1)C=C(C=C2)Br.Br |
Computed by PubChem (NCBI)