cas: 392-92-7 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-(trifluoromethyl)phenol, 95+% (CAS 392-92-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A706420-25g |
| cas | 392-92-7 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 28759.57 Pln | |
| AmBeed | 10g | 14710.99 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dibromo-6-(trifluoromethyl)phenol (CAS 392-92-7) is a chemical compound with the molecular formula C7H3Br2F3O and a molecular weight of 319.90 g/mol. IUPAC name: 2,4-dibromo-6-(trifluoromethyl)phenol. InChIKey: DJPAQOCIUDXBHK-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 2,4-dibromo-6-(trifluoromethyl)phenol |
| InChIKey | DJPAQOCIUDXBHK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)O)Br)Br |
Computed by PubChem (NCBI)