cas: 19578-69-9 — see every product listed under this CAS number, including other names
2,4-Dichloro-1-(phenylmethoxy)benzene (CAS 19578-69-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632304-1G |
| cas | 19578-69-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3402.99 Pln | |
| Fluorochem | 5g | 10067.31 Pln |
| delivery time | 3-4 weeks |
|---|
2,4-dichloro-1-phenylmethoxybenzene (CAS 19578-69-9) is a chemical compound with the molecular formula C13H10Cl2O and a molecular weight of 253.12 g/mol. IUPAC name: 2,4-dichloro-1-phenylmethoxybenzene. InChIKey: VGXNWZVQHZSHCK-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 2,4-dichloro-1-phenylmethoxybenzene |
| InChIKey | VGXNWZVQHZSHCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)