CAS 21524-44-7 appears in our catalog under these names: 2-(Benzyloxy)-1,3-dichlorobenzene, 96%, 2-(Benzyloxy)-1,3-dichlorobenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
1,3-dichloro-2-phenylmethoxybenzene (CAS 21524-44-7) is a chemical compound with the molecular formula C13H10Cl2O and a molecular weight of 253.12 g/mol. IUPAC name: 1,3-dichloro-2-phenylmethoxybenzene. InChIKey: KPKWNVSAHAHCTE-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 1,3-dichloro-2-phenylmethoxybenzene |
| InChIKey | KPKWNVSAHAHCTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)