CAS 68240-78-8 appears in our catalog under these names: (3,4-Dichlorophenyl)(phenyl)methanol, 98%, 3,4'-Dichlorobenzhydrol, 95+%, (3,4-dichlorophenyl)(phenyl)methanol, ≥95%, ≥95%, 3,4-Dichlorobenzhydrol, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
(3,4-dichlorophenyl)-phenylmethanol (CAS 68240-78-8) is a chemical compound with the molecular formula C13H10Cl2O and a molecular weight of 253.12 g/mol. IUPAC name: (3,4-dichlorophenyl)-phenylmethanol. InChIKey: DALLAISNTUBBNX-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-phenylmethanol |
| InChIKey | DALLAISNTUBBNX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)