cas: 61693-43-4 — see every product listed under this CAS number, including other names
2,4-Dichloro-3-aminophenol hydrochloride, 98%, 98% (CAS 61693-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148CV-100mg |
| cas | 61693-43-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 213.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-amino-2,4-dichlorophenol;hydrochloride (CAS 61693-43-4) is a chemical compound with the molecular formula C6H6Cl3NO and a molecular weight of 214.5 g/mol. IUPAC name: 3-amino-2,4-dichlorophenol;hydrochloride. InChIKey: MQWQWQBIVSVACH-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl3NO |
|---|---|
| Molecular weight | 214.5 g/mol |
| IUPAC name | 3-amino-2,4-dichlorophenol;hydrochloride |
| InChIKey | MQWQWQBIVSVACH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)Cl)N)Cl.Cl |
Computed by PubChem (NCBI)