Products 2230802-61-4

CAS 2230802-61-4 appears in our catalog under these names: (3,5-Dichloropyridin-2-yl)methanol hydrochloride, 95%, (3,5-Dichloropyridin-2-yl)methanol hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

(3,5-dichloro-2-pyridinyl)methanol;hydrochloride (CAS 2230802-61-4) is a chemical compound with the molecular formula C6H6Cl3NO and a molecular weight of 214.5 g/mol. IUPAC name: (3,5-dichloro-2-pyridinyl)methanol;hydrochloride. InChIKey: SPAHLEDVGUEVSH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6Cl3NO
Molecular weight214.5 g/mol
IUPAC name(3,5-dichloro-2-pyridinyl)methanol;hydrochloride
InChIKeySPAHLEDVGUEVSH-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1Cl)CO)Cl.Cl

Computed by PubChem (NCBI)