Products 197178-93-1

CAS 197178-93-1 is the registry number for 5-Amino-2,4-dichlorophenol hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-amino-2,4-dichlorophenol;hydrochloride (CAS 197178-93-1) is a chemical compound with the molecular formula C6H6Cl3NO and a molecular weight of 214.5 g/mol. IUPAC name: 5-amino-2,4-dichlorophenol;hydrochloride. InChIKey: FTMLWEVHTJTOLS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6Cl3NO
Molecular weight214.5 g/mol
IUPAC name5-amino-2,4-dichlorophenol;hydrochloride
InChIKeyFTMLWEVHTJTOLS-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1O)Cl)Cl)N.Cl

Computed by PubChem (NCBI)