CAS 197178-93-1 is the registry number for 5-Amino-2,4-dichlorophenol hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
5-amino-2,4-dichlorophenol;hydrochloride (CAS 197178-93-1) is a chemical compound with the molecular formula C6H6Cl3NO and a molecular weight of 214.5 g/mol. IUPAC name: 5-amino-2,4-dichlorophenol;hydrochloride. InChIKey: FTMLWEVHTJTOLS-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl3NO |
|---|---|
| Molecular weight | 214.5 g/mol |
| IUPAC name | 5-amino-2,4-dichlorophenol;hydrochloride |
| InChIKey | FTMLWEVHTJTOLS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)