cas: 62593-17-3 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-(trifluoromethyl)aniline, 97%, 97% (CAS 62593-17-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0N7-250mg |
| cas | 62593-17-3 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 100g | 698.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-6-(trifluoromethyl)aniline (CAS 62593-17-3) is a chemical compound with the molecular formula C7H4Cl2F3N and a molecular weight of 230.01 g/mol. IUPAC name: 2,4-dichloro-6-(trifluoromethyl)aniline. InChIKey: OCJPQZFOBGQYEA-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3N |
|---|---|
| Molecular weight | 230.01 g/mol |
| IUPAC name | 2,4-dichloro-6-(trifluoromethyl)aniline |
| InChIKey | OCJPQZFOBGQYEA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)Cl)Cl |
Computed by PubChem (NCBI)