CAS 62593-17-3 appears in our catalog under these names: 2-Amino-3,5-dichlorobenzotrifluoride, 97%, 2–Amino–3,5–Dichlorobenzotrifluoride, 2,4-Dichloro-6-(trifluoromethyl)aniline 97%, 2,4-Dichloro-6-(trifluoromethyl)aniline, 97%, 97%, 2,4-Dichloro-6-(trifluoromethyl)aniline, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg.
2,4-dichloro-6-(trifluoromethyl)aniline (CAS 62593-17-3) is a chemical compound with the molecular formula C7H4Cl2F3N and a molecular weight of 230.01 g/mol. IUPAC name: 2,4-dichloro-6-(trifluoromethyl)aniline. InChIKey: OCJPQZFOBGQYEA-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3N |
|---|---|
| Molecular weight | 230.01 g/mol |
| IUPAC name | 2,4-dichloro-6-(trifluoromethyl)aniline |
| InChIKey | OCJPQZFOBGQYEA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)Cl)Cl |
Computed by PubChem (NCBI)