Products 103995-81-9
CAS 103995-81-9 appears in our catalog under these names: 2,5-Dichloro-3-(trifluoromethyl)aniline, 95%, 2,5-Dichloro-3-(trifluoromethyl)aniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
2,5-dichloro-3-(trifluoromethyl)aniline (CAS 103995-81-9) is a chemical compound with the molecular formula C7H4Cl2F3N and a molecular weight of 230.01 g/mol. IUPAC name: 2,5-dichloro-3-(trifluoromethyl)aniline. InChIKey: VYVZNQXTBHGTEN-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3N |
|---|---|
| Molecular weight | 230.01 g/mol |
| IUPAC name | 2,5-dichloro-3-(trifluoromethyl)aniline |
| InChIKey | VYVZNQXTBHGTEN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)N)Cl |
Computed by PubChem (NCBI)