cas: 1192711-71-9 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine 98% (CAS 1192711-71-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208020-100mg |
| cas | 1192711-71-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2139.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A208020 |
2,4-dichloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 1192711-71-9) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 2,4-dichloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: QOEYSTWXKJBVQE-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 2,4-dichloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | QOEYSTWXKJBVQE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)