Products 1059191-52-4

CAS 1059191-52-4 appears in our catalog under these names: 5,7-Dichloro-2-methyl-imidazo[1,2-c]pyrimidine, 95%, 5,7-dichloro-2-methyl-Imidazo(1,2-c)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

5,7-dichloro-2-methylimidazo[1,2-c]pyrimidine (CAS 1059191-52-4) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 5,7-dichloro-2-methylimidazo[1,2-c]pyrimidine. InChIKey: XRNTVVRDPNUQET-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2N3
Molecular weight202.04 g/mol
IUPAC name5,7-dichloro-2-methylimidazo[1,2-c]pyrimidine
InChIKeyXRNTVVRDPNUQET-UHFFFAOYSA-N
SMILESCC1=CN2C(=N1)C=C(N=C2Cl)Cl

Computed by PubChem (NCBI)