CAS 934524-10-4 appears in our catalog under these names: 2,4-Dichloro-7-tosyl-7h-pyrrolo[2,3-d]pyrimidine, 98%, Tofacitinib Impurity 83, 2,4–Dichloro–7–tosyl–7h–pyrrolo(2,3–d)pyrimidine, 2,4-Dichloro-7-tosyl-7H-pyrrolo[2,3-d]pyrimidine, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, on request, 100mg, 500mg.
2,4-dichloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine (CAS 934524-10-4) is a chemical compound with the molecular formula C13H9Cl2N3O2S and a molecular weight of 342.2 g/mol. IUPAC name: 2,4-dichloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine. InChIKey: DTDGVNQSPAWHTH-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3O2S |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | 2,4-dichloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine |
| InChIKey | DTDGVNQSPAWHTH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2N=C(N=C3Cl)Cl |
Computed by PubChem (NCBI)