Products 2703756-60-7
CAS 2703756-60-7 is the registry number for 4,6-Dichloro-1-tosyl-1H-pyrazolo[4,3-c]pyridine, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4,6-dichloro-1-(4-methylphenyl)sulfonylpyrazolo[4,3-c]pyridine (CAS 2703756-60-7) is a chemical compound with the molecular formula C13H9Cl2N3O2S and a molecular weight of 342.2 g/mol. IUPAC name: 4,6-dichloro-1-(4-methylphenyl)sulfonylpyrazolo[4,3-c]pyridine. InChIKey: FWNGINVRRZNEAJ-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3O2S |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | 4,6-dichloro-1-(4-methylphenyl)sulfonylpyrazolo[4,3-c]pyridine |
| InChIKey | FWNGINVRRZNEAJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3=CC(=NC(=C3C=N2)Cl)Cl |
Computed by PubChem (NCBI)