Products 2521770-35-2
CAS 2521770-35-2 is the registry number for Anticancer agent 70. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,4-dichloro-N-(1H-indazol-7-yl)benzenesulfonamide (CAS 2521770-35-2) is a chemical compound with the molecular formula C13H9Cl2N3O2S and a molecular weight of 342.2 g/mol. IUPAC name: 2,4-dichloro-N-(1H-indazol-7-yl)benzenesulfonamide. InChIKey: URDFXYJXTZQRSU-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3O2S |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | 2,4-dichloro-N-(1H-indazol-7-yl)benzenesulfonamide |
| InChIKey | URDFXYJXTZQRSU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NS(=O)(=O)C3=C(C=C(C=C3)Cl)Cl)NN=C2 |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 70, orb1688940