2,4-Dichlorophenylboronic acid 98%
cas: 68716-47-2 — see every product listed under this CAS number, including other names
2,4-Dichlorophenylboronic acid 98% (CAS 68716-47-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163466-1g |
| cas | 68716-47-2 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 693.00 Pln | |
| Ambeed | 500g | 3179.44 Pln | |
| Ambeed | 1000g | 5048.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A163466 |
(2,4-dichlorophenyl)boronic acid (CAS 68716-47-2) is a chemical compound with the molecular formula C6H5BCl2O2 and a molecular weight of 190.82 g/mol. IUPAC name: (2,4-dichlorophenyl)boronic acid. InChIKey: QNEGDGPAXKYZHZ-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O2 |
|---|---|
| Molecular weight | 190.82 g/mol |
| IUPAC name | (2,4-dichlorophenyl)boronic acid |
| InChIKey | QNEGDGPAXKYZHZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,4-dichlorophenyl)boronic acid, 2,4-Dichlorophenylboronic acid, 2,4-Dichlorobenzeneboronic acid, 2,4-dichlorophenylbornic acid, (2,4-Dichlorophenyl)Boranediol, 2,4-Dichlorophenyl boronic acid, 2,4-Dichlorobenzenboronic acid, 2,4-dichloro phenyl boronic acid, (2,4-dichlorophenyl) boronic acid, Boronic acid, B-(2,4-dichlorophenyl)-