2,4-Dichlorophenylboronic acid, 97%
cas: 68716-47-2 — see every product listed under this CAS number, including other names
2,4-Dichlorophenylboronic acid, 97% (CAS 68716-47-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 367670010 |
| cas | 68716-47-2 |
| size | 1g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 93.54 Pln | |
| Thermo Scientific (Acros) | 5g | 312.70 Pln | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 216.61 Pln | |
| Fluorochem | 100g | 685.19 Pln | |
| Fluorochem | 500g | 2845.89 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
(2,4-dichlorophenyl)boronic acid (CAS 68716-47-2) is a chemical compound with the molecular formula C6H5BCl2O2 and a molecular weight of 190.82 g/mol. IUPAC name: (2,4-dichlorophenyl)boronic acid. InChIKey: QNEGDGPAXKYZHZ-UHFFFAOYSA-N.
| Molecular formula | C6H5BCl2O2 |
|---|---|
| Molecular weight | 190.82 g/mol |
| IUPAC name | (2,4-dichlorophenyl)boronic acid |
| InChIKey | QNEGDGPAXKYZHZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,4-dichlorophenyl)boronic acid, 2,4-Dichlorophenylboronic acid, 2,4-Dichlorobenzeneboronic acid, 2,4-dichlorophenylbornic acid, (2,4-Dichlorophenyl)Boranediol, 2,4-Dichlorophenyl boronic acid, 2,4-Dichlorobenzenboronic acid, 2,4-dichloro phenyl boronic acid, (2,4-dichlorophenyl) boronic acid, Boronic acid, B-(2,4-dichlorophenyl)-