cas: 528-75-6 — see every product listed under this CAS number, including other names
2,4-Dinitrobenzaldehyde, >98.0%(GC) (CAS 528-75-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D6153-5G |
| cas | 528-75-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 260.95 Pln | |
| TCI | 25g | 782.17 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,4-dinitrobenzaldehyde (CAS 528-75-6) is a chemical compound with the molecular formula C7H4N2O5 and a molecular weight of 196.12 g/mol. IUPAC name: 2,4-dinitrobenzaldehyde. InChIKey: ZILXIZUBLXVYPI-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O5 |
|---|---|
| Molecular weight | 196.12 g/mol |
| IUPAC name | 2,4-dinitrobenzaldehyde |
| InChIKey | ZILXIZUBLXVYPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)