cas: 528-75-6 — see every product listed under this CAS number, including other names
2,4-Dinitrobenzaldehyde, 97%, 97% (CAS 528-75-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FUX-1g |
| cas | 528-75-6 |
| size | 1g |
| availability | 261g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 64.40 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 323.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dinitrobenzaldehyde (CAS 528-75-6) is a chemical compound with the molecular formula C7H4N2O5 and a molecular weight of 196.12 g/mol. IUPAC name: 2,4-dinitrobenzaldehyde. InChIKey: ZILXIZUBLXVYPI-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O5 |
|---|---|
| Molecular weight | 196.12 g/mol |
| IUPAC name | 2,4-dinitrobenzaldehyde |
| InChIKey | ZILXIZUBLXVYPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)