cas: 1805471-65-1 — see every product listed under this CAS number, including other names
2,4-dibromo-1,5-difluoro-3-iodobenzene, 95%+, 95%+ (CAS 1805471-65-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KBIJ-100mg |
| cas | 1805471-65-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2474.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
2,4-dibromo-1,5-difluoro-3-iodobenzene (CAS 1805471-65-1) is a chemical compound with the molecular formula C6HBr2F2I and a molecular weight of 397.78 g/mol. IUPAC name: 2,4-dibromo-1,5-difluoro-3-iodobenzene. InChIKey: SJUDKAZXHQGGDA-UHFFFAOYSA-N.
| Molecular formula | C6HBr2F2I |
|---|---|
| Molecular weight | 397.78 g/mol |
| IUPAC name | 2,4-dibromo-1,5-difluoro-3-iodobenzene |
| InChIKey | SJUDKAZXHQGGDA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)I)Br)F |
Computed by PubChem (NCBI)