CAS 1160574-21-9 is the registry number for 1,3-Dibromo-4,5-difluoro-2-iodobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,3-dibromo-4,5-difluoro-2-iodobenzene (CAS 1160574-21-9) is a chemical compound with the molecular formula C6HBr2F2I and a molecular weight of 397.78 g/mol. IUPAC name: 1,3-dibromo-4,5-difluoro-2-iodobenzene. InChIKey: XWMAAPTWMPDZJY-UHFFFAOYSA-N.
| Molecular formula | C6HBr2F2I |
|---|---|
| Molecular weight | 397.78 g/mol |
| IUPAC name | 1,3-dibromo-4,5-difluoro-2-iodobenzene |
| InChIKey | XWMAAPTWMPDZJY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)I)Br)F)F |
Computed by PubChem (NCBI)