CAS 1805471-65-1 appears in our catalog under these names: 1,3-Dibromo-4,6-difluoro-2-iodobenzene, 95%, 2,4-dibromo-1,5-difluoro-3-iodobenzene, 95%+, 95%+. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
2,4-dibromo-1,5-difluoro-3-iodobenzene (CAS 1805471-65-1) is a chemical compound with the molecular formula C6HBr2F2I and a molecular weight of 397.78 g/mol. IUPAC name: 2,4-dibromo-1,5-difluoro-3-iodobenzene. InChIKey: SJUDKAZXHQGGDA-UHFFFAOYSA-N.
| Molecular formula | C6HBr2F2I |
|---|---|
| Molecular weight | 397.78 g/mol |
| IUPAC name | 2,4-dibromo-1,5-difluoro-3-iodobenzene |
| InChIKey | SJUDKAZXHQGGDA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)I)Br)F |
Computed by PubChem (NCBI)