cas: 2306276-28-6 — see every product listed under this CAS number, including other names
2,4-dichloro-6-fluoropyrrolo[2,1-f][1,2,4]triazine, 97% (CAS 2306276-28-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch13156T-100mg |
| cas | 2306276-28-6 |
| size | 100mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1490.00 Pln | |
| Chemat | 250mg | 2440.40 Pln | |
| Chemat | 500mg | 4024.40 Pln | |
| Fluorochem | 100mg | 2767.79 Pln | |
| Fluorochem | 250mg | 4522.38 Pln | |
| Fluorochem | 500mg | 7328.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-6-fluoropyrrolo[2,1-f][1,2,4]triazine (CAS 2306276-28-6) is a chemical compound with the molecular formula C6H2Cl2FN3 and a molecular weight of 206.00 g/mol. IUPAC name: 2,4-dichloro-6-fluoropyrrolo[2,1-f][1,2,4]triazine. InChIKey: JBUGQTITFUMRDH-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FN3 |
|---|---|
| Molecular weight | 206.00 g/mol |
| IUPAC name | 2,4-dichloro-6-fluoropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | JBUGQTITFUMRDH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=NN2C=C1F)Cl)Cl |
Computed by PubChem (NCBI)