CAS 2306276-28-6 appears in our catalog under these names: 2,4-Dichloro-6-fluoropyrrolo(2,1-f)(1,2,4)triazine, 97%, 2,4-dichloro-6-fluoropyrrolo[2,1-f][1,2,4]triazine, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
2,4-dichloro-6-fluoropyrrolo[2,1-f][1,2,4]triazine (CAS 2306276-28-6) is a chemical compound with the molecular formula C6H2Cl2FN3 and a molecular weight of 206.00 g/mol. IUPAC name: 2,4-dichloro-6-fluoropyrrolo[2,1-f][1,2,4]triazine. InChIKey: JBUGQTITFUMRDH-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FN3 |
|---|---|
| Molecular weight | 206.00 g/mol |
| IUPAC name | 2,4-dichloro-6-fluoropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | JBUGQTITFUMRDH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=NN2C=C1F)Cl)Cl |
Computed by PubChem (NCBI)