Products 1159196-39-0
CAS 1159196-39-0 is the registry number for 5,7-dichloro-2-fluoropyrazolo[1,5-a]pyrimidine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5,7-dichloro-2-fluoropyrazolo[1,5-a]pyrimidine (CAS 1159196-39-0) is a chemical compound with the molecular formula C6H2Cl2FN3 and a molecular weight of 206.00 g/mol. IUPAC name: 5,7-dichloro-2-fluoropyrazolo[1,5-a]pyrimidine. InChIKey: YNPVKHLNGVZWQX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FN3 |
|---|---|
| Molecular weight | 206.00 g/mol |
| IUPAC name | 5,7-dichloro-2-fluoropyrazolo[1,5-a]pyrimidine |
| InChIKey | YNPVKHLNGVZWQX-UHFFFAOYSA-N |
| SMILES | C1=C2N=C(C=C(N2N=C1F)Cl)Cl |
Computed by PubChem (NCBI)