2,5,8,11,14,17,20,23,26-Nonaoxanonacosan-29-oic acid, 95%
cas: 2576495-35-5 — see every product listed under this CAS number, including other names
2,5,8,11,14,17,20,23,26-Nonaoxanonacosan-29-oic acid, 95% (CAS 2576495-35-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD00836644-250mg |
| cas | 2576495-35-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 250mg | 292.14 Pln | |
| BLDpharm | 1g | 642.02 Pln | |
| BLDpharm | 5g | 2352.53 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 1173.20 Pln | |
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 242.64 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 2090.95 Pln | |
| Fluorochem | 10g | 3569.59 Pln | |
| Fluorochem | 25g | 6927.79 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2576495-35-5) is a chemical compound with the molecular formula C20H40O11 and a molecular weight of 456.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: HVDSDOIAPZITDA-UHFFFAOYSA-N.
| Molecular formula | C20H40O11 |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | HVDSDOIAPZITDA-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)