CAS 2576495-35-5 appears in our catalog under these names: m-PEG9-acid, 95%, m–PEG9–acid, m-PEG9-acid 95%, 2,5,8,11,14,17,20,23,26-Nonaoxanonacosan-29-oic acid, 95%, 95%, m-PEG9-acid, 99.69%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 5g, 250 mg, 10 g, 1 g, 25 g.
3-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2576495-35-5) is a chemical compound with the molecular formula C20H40O11 and a molecular weight of 456.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: HVDSDOIAPZITDA-UHFFFAOYSA-N.
| Molecular formula | C20H40O11 |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | HVDSDOIAPZITDA-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)