2,5-Bis(2,2,2-trifluoroethoxy)benzoic Acid, 98%
cas: 35480-52-5 — see every product listed under this CAS number, including other names
2,5-Bis(2,2,2-trifluoroethoxy)benzoic Acid, 98% (CAS 35480-52-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114FVV-5g |
| cas | 35480-52-5 |
| size | 5g |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 500g | 686.40 Pln | |
| Chemat | 1kg | 1293.20 Pln | |
| BLDpharm | 5g | 181.07 Pln | |
| BLDpharm | 25g | 203.29 Pln | |
| BLDpharm | 100g | 297.70 Pln | |
| BLDpharm | 500g | 1069.65 Pln | |
| Fluorochem | 100g | 289.50 Pln | |
| Fluorochem | 500g | 976.76 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,5-bis(2,2,2-trifluoroethoxy)benzoic acid (CAS 35480-52-5) is a chemical compound with the molecular formula C11H8F6O4 and a molecular weight of 318.17 g/mol. IUPAC name: 2,5-bis(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: YPGYLCZBZKRYQJ-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O4 |
|---|---|
| Molecular weight | 318.17 g/mol |
| IUPAC name | 2,5-bis(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | YPGYLCZBZKRYQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)C(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2,5-bis(2,2,2-trifluoroethoxy)benzoic Acid, FLECAINIDE ACID, FLECAINIDE ACID [USP IMPURITY], FLECAINIDE ACID (USP IMPURITY), 2,5-bis(trifluoroethoxy)benzoic acid, Flecainide IMpurity D, Flecainide acetate impurity D, 2,5-Bis(2,2,2-trifluoroethoxy)benzoicAcid-d3, Flecainide EP Impurity D, 2,5-Bis(2,2,2-trifluoroethoxy)benzoicAcid