cas: 16691-79-5 — see every product listed under this CAS number, including other names
2,5-Bis(methoxycarbonyl)-3,4-diphenylcyclopentadienone (CAS 16691-79-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1962-1G |
| cas | 16691-79-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 383.88 Pln | |
| TCI | 5g | 1313.24 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
Dimethyl 2-oxo-4,5-diphenylcyclopenta-3,5-diene-1,3-dicarboxylate (CAS 16691-79-5) is a chemical compound with the molecular formula C21H16O5 and a molecular weight of 348.3 g/mol. IUPAC name: dimethyl 2-oxo-4,5-diphenylcyclopenta-3,5-diene-1,3-dicarboxylate. InChIKey: NTXFYWYVVGMAGT-UHFFFAOYSA-N.
| Molecular formula | C21H16O5 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | dimethyl 2-oxo-4,5-diphenylcyclopenta-3,5-diene-1,3-dicarboxylate |
| InChIKey | NTXFYWYVVGMAGT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C1=O)C(=O)OC)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)